C24H34O5 — CID 162900386
[(1R,4aS,7E,11aR)-4-[(1R)-1-acetyloxy-4-methylpent-3-enyl]-7-methyl-11-methylidene-4a,5,6,9,10,11a-hexahydro-1H-cyclonona[c]pyran-1-yl] acetate (PubChem CID 162900386) has the molecular formula C24H34O5 and a molecular weight of 402.53 g/mol. Its IUPAC name is [(1R,4aS,7E,11aR)-4-[(1R)-1-acetyloxy-4-methylpent-3-enyl]-7-methyl-11-methylidene-4a,5,6,9,10,11a-hexahydro-1H-cyclonona[c]pyran-1-yl] acetate.
| Compound Name | [(1R,4aS,7E,11aR)-4-[(1R)-1-acetyloxy-4-methylpent-3-enyl]-7-methyl-11-methylidene-4a,5,6,9,10,11a-hexahydro-1H-cyclonona[c]pyran-1-yl] acetate |
|---|---|
| PubChem CID | 162900386 |
| Molecular Formula | C24H34O5 |
| Molecular Weight | 402.53 g/mol |
| Exact Mass | 402.24 |
| IUPAC Name | [(1R,4aS,7E,11aR)-4-[(1R)-1-acetyloxy-4-methylpent-3-enyl]-7-methyl-11-methylidene-4a,5,6,9,10,11a-hexahydro-1H-cyclonona[c]pyran-1-yl] acetate |
| SMILES | C=C1CC/C=C(\C)CC[C@@H]2C([C@@H](CC=C(C)C)OC(C)=O)=CO[C@H](OC(C)=O)[C@@H]12 |
| InChI | InChI=1S/C24H34O5/c1-15(2)10-13-22(28-18(5)25)21-14-27-24(29-19(6)26)23-17(4)9-7-8-16(3)11-12-20(21)23/h8,10,14,20,22-24H,4,7,9,11-13H2,1-3,5-6H3/b16-8+/t20-,22-,23+,24-/m1/s1 |
| InChIKey | TVJNNVZCBNICJU-LJBKCOLSSA-N |
| XLogP | 5.39 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.53 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|