C31H50O3 — CID 162900685
2-[(2R,4aR,6aS,6aR,8aS,9R,14aS)-2,4a,6a,6a,8a,9,14a-heptamethyl-10-oxo-3,4,5,6,6b,7,8,9,11,12,12a,13,14,14b-tetradecahydro-1H-picen-2-yl]acetic acid (PubChem CID 162900685) has the molecular formula C31H50O3 and a molecular weight of 470.74 g/mol. Its IUPAC name is 2-[(2R,4aR,6aS,6aR,8aS,9R,14aS)-2,4a,6a,6a,8a,9,14a-heptamethyl-10-oxo-3,4,5,6,6b,7,8,9,11,12,12a,13,14,14b-tetradecahydro-1H-picen-2-yl]acetic acid.
| Compound Name | 2-[(2R,4aR,6aS,6aR,8aS,9R,14aS)-2,4a,6a,6a,8a,9,14a-heptamethyl-10-oxo-3,4,5,6,6b,7,8,9,11,12,12a,13,14,14b-tetradecahydro-1H-picen-2-yl]acetic acid |
|---|---|
| PubChem CID | 162900685 |
| Molecular Formula | C31H50O3 |
| Molecular Weight | 470.74 g/mol |
| Exact Mass | 470.38 |
| IUPAC Name | 2-[(2R,4aR,6aS,6aR,8aS,9R,14aS)-2,4a,6a,6a,8a,9,14a-heptamethyl-10-oxo-3,4,5,6,6b,7,8,9,11,12,12a,13,14,14b-tetradecahydro-1H-picen-2-yl]acetic acid |
| SMILES | C[C@H]1C(=O)CCC2[C@]3(C)CC[C@@]4(C)C5C[C@](C)(CC(=O)O)CC[C@]5(C)CC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C31H50O3/c1-20-21(32)8-9-22-28(20,4)11-10-23-29(22,5)15-17-31(7)24-18-26(2,19-25(33)34)12-13-27(24,3)14-16-30(23,31)6/h20,22-24H,8-19H2,1-7H3,(H,33,34)/t20-,22?,23?,24?,26+,27+,28+,29-,30+,31-/m0/s1 |
| InChIKey | IXNDLYSEFZRJIJ-QIXKMHTASA-N |
| XLogP | 7.91 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.74 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |