C27H52O14 — CID 162900727
(2R,3S,4S,5R,6R)-3,4-dimethoxy-2-(methoxymethyl)-6-[(2S,3S,4S)-1,3,4,5-tetramethoxypentan-2-yl]oxy-5-[(2R,3S,4R,5R,6S)-3,4,5-trimethoxy-6-methyloxan-2-yl]oxyoxane (PubChem CID 162900727) has the molecular formula C27H52O14 and a molecular weight of 600.70 g/mol. Its IUPAC name is (2R,3S,4S,5R,6R)-3,4-dimethoxy-2-(methoxymethyl)-6-[(2S,3S,4S)-1,3,4,5-tetramethoxypentan-2-yl]oxy-5-[(2R,3S,4R,5R,6S)-3,4,5-trimethoxy-6-methyloxan-2-yl]oxyoxane.
| Compound Name | (2R,3S,4S,5R,6R)-3,4-dimethoxy-2-(methoxymethyl)-6-[(2S,3S,4S)-1,3,4,5-tetramethoxypentan-2-yl]oxy-5-[(2R,3S,4R,5R,6S)-3,4,5-trimethoxy-6-methyloxan-2-yl]oxyoxane |
|---|---|
| PubChem CID | 162900727 |
| Molecular Formula | C27H52O14 |
| Molecular Weight | 600.70 g/mol |
| Exact Mass | 600.34 |
| IUPAC Name | (2R,3S,4S,5R,6R)-3,4-dimethoxy-2-(methoxymethyl)-6-[(2S,3S,4S)-1,3,4,5-tetramethoxypentan-2-yl]oxy-5-[(2R,3S,4R,5R,6S)-3,4,5-trimethoxy-6-methyloxan-2-yl]oxyoxane |
| SMILES | COC[C@H](OC)[C@H](OC)[C@H](COC)O[C@@H]1O[C@H](COC)[C@H](OC)[C@H](OC)[C@H]1O[C@H]1O[C@@H](C)[C@@H](OC)[C@@H](OC)[C@@H]1OC |
| InChI | InChI=1S/C27H52O14/c1-15-19(32-6)22(35-9)24(37-11)26(38-15)41-25-23(36-10)21(34-8)18(14-30-4)40-27(25)39-17(13-29-3)20(33-7)16(31-5)12-28-2/h15-27H,12-14H2,1-11H3/t15-,16-,17-,18+,19+,20-,21-,22+,23-,24-,25+,26+,27+/m0/s1 |
| InChIKey | LQLWTXHROXBIJK-IKOVGOCTSA-N |
| XLogP | 0.27 |
| TPSA | 129.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.70 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |