C16H22O4 — CID 162901013
[(1R,4R,5R)-4-acetyloxy-6-methylidene-5-prop-1-en-2-ylcyclohex-2-en-1-yl] 2-methylpropanoate (PubChem CID 162901013) has the molecular formula C16H22O4 and a molecular weight of 278.35 g/mol. Its IUPAC name is [(1R,4R,5R)-4-acetyloxy-6-methylidene-5-prop-1-en-2-ylcyclohex-2-en-1-yl] 2-methylpropanoate.
| Compound Name | [(1R,4R,5R)-4-acetyloxy-6-methylidene-5-prop-1-en-2-ylcyclohex-2-en-1-yl] 2-methylpropanoate |
|---|---|
| PubChem CID | 162901013 |
| Molecular Formula | C16H22O4 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | [(1R,4R,5R)-4-acetyloxy-6-methylidene-5-prop-1-en-2-ylcyclohex-2-en-1-yl] 2-methylpropanoate |
| SMILES | C=C(C)[C@@H]1C(=C)[C@H](OC(=O)C(C)C)C=C[C@H]1OC(C)=O |
| InChI | InChI=1S/C16H22O4/c1-9(2)15-11(5)13(20-16(18)10(3)4)7-8-14(15)19-12(6)17/h7-8,10,13-15H,1,5H2,2-4,6H3/t13-,14-,15-/m1/s1 |
| InChIKey | KGUMESDMUMWGCF-RBSFLKMASA-N |
| XLogP | 2.80 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|