About 2-[(3S)-3-hydroxy-3,7-dimethylocta-1,6-dienyl]-1-methylquinolin-4-one
2-[(3S)-3-hydroxy-3,7-dimethylocta-1,6-dienyl]-1-methylquinolin-4-one (PubChem CID 162901116) has the molecular formula C20H25NO2
and a molecular weight of 311.43 g/mol. Its IUPAC name is 2-[(3S)-3-hydroxy-3,7-dimethylocta-1,6-dienyl]-1-methylquinolin-4-one.
Molecular Properties
| Compound Name | 2-[(3S)-3-hydroxy-3,7-dimethylocta-1,6-dienyl]-1-methylquinolin-4-one |
| PubChem CID | 162901116 |
| Molecular Formula | C20H25NO2 |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.19 |
| IUPAC Name | 2-[(3S)-3-hydroxy-3,7-dimethylocta-1,6-dienyl]-1-methylquinolin-4-one |
| SMILES | CC(C)=CCC[C@](C)(O)C=Cc1cc(=O)c2ccccc2n1C |
| InChI | InChI=1S/C20H25NO2/c1-15(2)8-7-12-20(3,23)13-11-16-14-19(22)17-9-5-6-10-18(17)21(16)4/h5-6,8-11,13-14,23H,7,12H2,1-4H3/t20-/m0/s1 |
| InChIKey | VUAZVPWKLXTCMY-FQEVSTJZSA-N |
| XLogP | 4.05 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(3S)-3-hydroxy-3,7-dimethylocta-1,6-dienyl]-1-methylquinolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3S)-3-hydroxy-3,7-dimethylocta-1,6-dienyl]-1-methylquinolin-4-one?
The IUPAC name of 2-[(3S)-3-hydroxy-3,7-dimethylocta-1,6-dienyl]-1-methylquinolin-4-one (CID 162901116) is 2-[(3S)-3-hydroxy-3,7-dimethylocta-1,6-dienyl]-1-methylquinolin-4-one.
What is the SMILES notation for 2-[(3S)-3-hydroxy-3,7-dimethylocta-1,6-dienyl]-1-methylquinolin-4-one?
The canonical SMILES for 2-[(3S)-3-hydroxy-3,7-dimethylocta-1,6-dienyl]-1-methylquinolin-4-one is CC(C)=CCC[C@](C)(O)C=Cc1cc(=O)c2ccccc2n1C.
What is the InChIKey of 2-[(3S)-3-hydroxy-3,7-dimethylocta-1,6-dienyl]-1-methylquinolin-4-one?
The InChIKey is VUAZVPWKLXTCMY-FQEVSTJZSA-N. The full InChI is InChI=1S/C20H25NO2/c1-15(2)8-7-12-20(3,23)13-11-16-14-19(22)17-9-5-6-10-18(17)21(16)4/h5-6,8-11,13-14,23H,7,12H2,1-4H3/t20-/m0/s1.
What are the key properties of 2-[(3S)-3-hydroxy-3,7-dimethylocta-1,6-dienyl]-1-methylquinolin-4-one?
2-[(3S)-3-hydroxy-3,7-dimethylocta-1,6-dienyl]-1-methylquinolin-4-one has a molecular weight of 311.43 g/mol, XLogP of 4.05, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3S)-3-hydroxy-3,7-dimethylocta-1,6-dienyl]-1-methylquinolin-4-one is sourced from PubChem (CID 162901116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).