C31H46O7 — CID 162901243
[15-acetyloxy-17-hydroxy-4,4,8,10,14-pentamethyl-17-(2-methyl-5-oxofuran-2-yl)-1,2,3,5,6,7,9,11,12,13,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 162901243) has the molecular formula C31H46O7 and a molecular weight of 530.70 g/mol. Its IUPAC name is [15-acetyloxy-17-hydroxy-4,4,8,10,14-pentamethyl-17-(2-methyl-5-oxofuran-2-yl)-1,2,3,5,6,7,9,11,12,13,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [15-acetyloxy-17-hydroxy-4,4,8,10,14-pentamethyl-17-(2-methyl-5-oxofuran-2-yl)-1,2,3,5,6,7,9,11,12,13,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 162901243 |
| Molecular Formula | C31H46O7 |
| Molecular Weight | 530.70 g/mol |
| Exact Mass | 530.32 |
| IUPAC Name | [15-acetyloxy-17-hydroxy-4,4,8,10,14-pentamethyl-17-(2-methyl-5-oxofuran-2-yl)-1,2,3,5,6,7,9,11,12,13,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | CC(=O)OC1CCC2(C)C(CCC3(C)C2CCC2C(O)(C4(C)C=CC(=O)O4)CC(OC(C)=O)C23C)C1(C)C |
| InChI | InChI=1S/C31H46O7/c1-18(32)36-23-12-14-27(5)20(26(23,3)4)11-15-28(6)21(27)9-10-22-30(28,8)24(37-19(2)33)17-31(22,35)29(7)16-13-25(34)38-29/h13,16,20-24,35H,9-12,14-15,17H2,1-8H3 |
| InChIKey | SFDSZFBIIOBSGC-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.70 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|