C26H36O4 — CID 162901355
methyl 5,9,13-trimethyl-6-(2-methylbut-2-enoyloxy)tetracyclo[11.2.1.01,10.04,9]hexadeca-10,14-diene-5-carboxylate (PubChem CID 162901355) has the molecular formula C26H36O4 and a molecular weight of 412.57 g/mol. Its IUPAC name is methyl 5,9,13-trimethyl-6-(2-methylbut-2-enoyloxy)tetracyclo[11.2.1.01,10.04,9]hexadeca-10,14-diene-5-carboxylate.
| Compound Name | methyl 5,9,13-trimethyl-6-(2-methylbut-2-enoyloxy)tetracyclo[11.2.1.01,10.04,9]hexadeca-10,14-diene-5-carboxylate |
|---|---|
| PubChem CID | 162901355 |
| Molecular Formula | C26H36O4 |
| Molecular Weight | 412.57 g/mol |
| Exact Mass | 412.26 |
| IUPAC Name | methyl 5,9,13-trimethyl-6-(2-methylbut-2-enoyloxy)tetracyclo[11.2.1.01,10.04,9]hexadeca-10,14-diene-5-carboxylate |
| SMILES | CC=C(C)C(=O)OC1CCC2(C)C3=CCC4(C)C=CC3(CCC2C1(C)C(=O)OC)C4 |
| InChI | InChI=1S/C26H36O4/c1-7-17(2)21(27)30-20-10-12-24(4)18(25(20,5)22(28)29-6)9-13-26-15-14-23(3,16-26)11-8-19(24)26/h7-8,14-15,18,20H,9-13,16H2,1-6H3 |
| InChIKey | PJWZGQUXXYMDML-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.57 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|