C20H30O3 — CID 162901512
(1R,2S,3R)-3-[(2S,5E)-6,10-dimethyl-1-oxoundeca-5,9-dien-2-yl]cyclopentane-1,2-dicarbaldehyde (PubChem CID 162901512) has the molecular formula C20H30O3 and a molecular weight of 318.46 g/mol. Its IUPAC name is (1R,2S,3R)-3-[(2S,5E)-6,10-dimethyl-1-oxoundeca-5,9-dien-2-yl]cyclopentane-1,2-dicarbaldehyde.
| Compound Name | (1R,2S,3R)-3-[(2S,5E)-6,10-dimethyl-1-oxoundeca-5,9-dien-2-yl]cyclopentane-1,2-dicarbaldehyde |
|---|---|
| PubChem CID | 162901512 |
| Molecular Formula | C20H30O3 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | (1R,2S,3R)-3-[(2S,5E)-6,10-dimethyl-1-oxoundeca-5,9-dien-2-yl]cyclopentane-1,2-dicarbaldehyde |
| SMILES | CC(C)=CCC/C(C)=C/CC[C@H](C=O)[C@H]1CC[C@@H](C=O)[C@H]1C=O |
| InChI | InChI=1S/C20H30O3/c1-15(2)6-4-7-16(3)8-5-9-17(12-21)19-11-10-18(13-22)20(19)14-23/h6,8,12-14,17-20H,4-5,7,9-11H2,1-3H3/b16-8+/t17-,18+,19-,20-/m1/s1 |
| InChIKey | HSCUXCZWEKXESM-ADYUUVJTSA-N |
| XLogP | 4.31 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|