C20H30O2 — CID 162901561
(1S,2Z,6E,10E,14S)-6,10,14-trimethyl-3-propan-2-yl-15-oxabicyclo[12.1.0]pentadeca-2,6,10-trien-4-one (PubChem CID 162901561) has the molecular formula C20H30O2 and a molecular weight of 302.46 g/mol. Its IUPAC name is (1S,2Z,6E,10E,14S)-6,10,14-trimethyl-3-propan-2-yl-15-oxabicyclo[12.1.0]pentadeca-2,6,10-trien-4-one.
| Compound Name | (1S,2Z,6E,10E,14S)-6,10,14-trimethyl-3-propan-2-yl-15-oxabicyclo[12.1.0]pentadeca-2,6,10-trien-4-one |
|---|---|
| PubChem CID | 162901561 |
| Molecular Formula | C20H30O2 |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | (1S,2Z,6E,10E,14S)-6,10,14-trimethyl-3-propan-2-yl-15-oxabicyclo[12.1.0]pentadeca-2,6,10-trien-4-one |
| SMILES | C/C1=C\CC[C@]2(C)O[C@H]2/C=C(/C(C)C)C(=O)C/C(C)=C/CC1 |
| InChI | InChI=1S/C20H30O2/c1-14(2)17-13-19-20(5,22-19)11-7-10-15(3)8-6-9-16(4)12-18(17)21/h9-10,13-14,19H,6-8,11-12H2,1-5H3/b15-10+,16-9+,17-13-/t19-,20-/m0/s1 |
| InChIKey | XYGZKBQEGUFULA-DXINRFBRSA-N |
| XLogP | 5.15 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|