C25H34O17 — CID 162901733
[4,5-diacetyloxy-6-[(3,4,5,6-tetraacetyloxyoxan-2-yl)methoxy]oxan-3-yl] acetate (PubChem CID 162901733) has the molecular formula C25H34O17 and a molecular weight of 606.53 g/mol. Its IUPAC name is [4,5-diacetyloxy-6-[(3,4,5,6-tetraacetyloxyoxan-2-yl)methoxy]oxan-3-yl] acetate.
| Compound Name | [4,5-diacetyloxy-6-[(3,4,5,6-tetraacetyloxyoxan-2-yl)methoxy]oxan-3-yl] acetate |
|---|---|
| PubChem CID | 162901733 |
| Molecular Formula | C25H34O17 |
| Molecular Weight | 606.53 g/mol |
| Exact Mass | 606.18 |
| IUPAC Name | [4,5-diacetyloxy-6-[(3,4,5,6-tetraacetyloxyoxan-2-yl)methoxy]oxan-3-yl] acetate |
| SMILES | CC(=O)OC1COC(OCC2OC(OC(C)=O)C(OC(C)=O)C(OC(C)=O)C2OC(C)=O)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C25H34O17/c1-10(26)35-17-8-33-24(22(39-14(5)30)20(17)37-12(3)28)34-9-18-19(36-11(2)27)21(38-13(4)29)23(40-15(6)31)25(42-18)41-16(7)32/h17-25H,8-9H2,1-7H3 |
| InChIKey | WRTUKZXRBLWQSG-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 211.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.53 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|