C29H24O8 — CID 162901895
(2R,3R,4R)-4-[2-[2-(3,4-dihydroxyphenyl)ethenyl]-4,6-dihydroxyphenyl]-2-(4-hydroxyphenyl)-3,4-dihydro-2H-chromene-3,7-diol (PubChem CID 162901895) has the molecular formula C29H24O8 and a molecular weight of 500.50 g/mol. Its IUPAC name is (2R,3R,4R)-4-[2-[2-(3,4-dihydroxyphenyl)ethenyl]-4,6-dihydroxyphenyl]-2-(4-hydroxyphenyl)-3,4-dihydro-2H-chromene-3,7-diol.
| Compound Name | (2R,3R,4R)-4-[2-[2-(3,4-dihydroxyphenyl)ethenyl]-4,6-dihydroxyphenyl]-2-(4-hydroxyphenyl)-3,4-dihydro-2H-chromene-3,7-diol |
|---|---|
| PubChem CID | 162901895 |
| Molecular Formula | C29H24O8 |
| Molecular Weight | 500.50 g/mol |
| Exact Mass | 500.15 |
| IUPAC Name | (2R,3R,4R)-4-[2-[2-(3,4-dihydroxyphenyl)ethenyl]-4,6-dihydroxyphenyl]-2-(4-hydroxyphenyl)-3,4-dihydro-2H-chromene-3,7-diol |
| SMILES | Oc1ccc([C@H]2Oc3cc(O)ccc3[C@H](c3c(O)cc(O)cc3C=Cc3ccc(O)c(O)c3)[C@H]2O)cc1 |
| InChI | InChI=1S/C29H24O8/c30-18-6-4-16(5-7-18)29-28(36)27(21-9-8-19(31)14-25(21)37-29)26-17(12-20(32)13-24(26)35)3-1-15-2-10-22(33)23(34)11-15/h1-14,27-36H/t27-,28-,29-/m1/s1 |
| InChIKey | QYHYXEIJGHPGEJ-MPFGFTFXSA-N |
| XLogP | 4.72 |
| TPSA | 150.84 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.50 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|