C24H27NO4 — CID 162902053
3-(2,6-dimethyl-1,2,4a,5,6,7,8,8a-octahydronaphthalene-1-carbonyl)-4-hydroxy-5-(4-hydroxyphenyl)-1H-pyridin-2-one (PubChem CID 162902053) has the molecular formula C24H27NO4 and a molecular weight of 393.48 g/mol. Its IUPAC name is 3-(2,6-dimethyl-1,2,4a,5,6,7,8,8a-octahydronaphthalene-1-carbonyl)-4-hydroxy-5-(4-hydroxyphenyl)-1H-pyridin-2-one.
| Compound Name | 3-(2,6-dimethyl-1,2,4a,5,6,7,8,8a-octahydronaphthalene-1-carbonyl)-4-hydroxy-5-(4-hydroxyphenyl)-1H-pyridin-2-one |
|---|---|
| PubChem CID | 162902053 |
| Molecular Formula | C24H27NO4 |
| Molecular Weight | 393.48 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | 3-(2,6-dimethyl-1,2,4a,5,6,7,8,8a-octahydronaphthalene-1-carbonyl)-4-hydroxy-5-(4-hydroxyphenyl)-1H-pyridin-2-one |
| SMILES | CC1CCC2C(C=CC(C)C2C(=O)c2c(O)c(-c3ccc(O)cc3)c[nH]c2=O)C1 |
| InChI | InChI=1S/C24H27NO4/c1-13-3-10-18-16(11-13)5-4-14(2)20(18)23(28)21-22(27)19(12-25-24(21)29)15-6-8-17(26)9-7-15/h4-9,12-14,16,18,20,26H,3,10-11H2,1-2H3,(H2,25,27,29) |
| InChIKey | DONHJHODAKWCJS-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.48 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|