C22H36O4 — CID 162902127
(2S,4S,5R,7R,8S,10S,12S)-10,12-dimethoxy-5-methyl-8-[(2R)-6-methylhept-5-en-2-yl]-11-oxatricyclo[7.3.0.02,4]dodec-1(9)-en-7-ol (PubChem CID 162902127) has the molecular formula C22H36O4 and a molecular weight of 364.53 g/mol. Its IUPAC name is (2S,4S,5R,7R,8S,10S,12S)-10,12-dimethoxy-5-methyl-8-[(2R)-6-methylhept-5-en-2-yl]-11-oxatricyclo[7.3.0.02,4]dodec-1(9)-en-7-ol.
| Compound Name | (2S,4S,5R,7R,8S,10S,12S)-10,12-dimethoxy-5-methyl-8-[(2R)-6-methylhept-5-en-2-yl]-11-oxatricyclo[7.3.0.02,4]dodec-1(9)-en-7-ol |
|---|---|
| PubChem CID | 162902127 |
| Molecular Formula | C22H36O4 |
| Molecular Weight | 364.53 g/mol |
| Exact Mass | 364.26 |
| IUPAC Name | (2S,4S,5R,7R,8S,10S,12S)-10,12-dimethoxy-5-methyl-8-[(2R)-6-methylhept-5-en-2-yl]-11-oxatricyclo[7.3.0.02,4]dodec-1(9)-en-7-ol |
| SMILES | CO[C@H]1O[C@H](OC)C2=C1[C@H]([C@H](C)CCC=C(C)C)[C@H](O)C[C@@H](C)[C@@H]1C[C@H]21 |
| InChI | InChI=1S/C22H36O4/c1-12(2)8-7-9-13(3)18-17(23)10-14(4)15-11-16(15)19-20(18)22(25-6)26-21(19)24-5/h8,13-18,21-23H,7,9-11H2,1-6H3/t13-,14-,15+,16+,17-,18-,21+,22+/m1/s1 |
| InChIKey | DATTZPFKKNYKHD-VEXRBORRSA-N |
| XLogP | 4.29 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.53 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|