C21H26N2O2 — CID 162902841
1-[(4R,12S,13R,16R,17S,18R,20S)-16-methyl-15-oxa-1,11-diazahexacyclo[15.3.1.04,12.04,20.05,10.013,18]henicosa-5,7,9-trien-11-yl]ethanone (PubChem CID 162902841) has the molecular formula C21H26N2O2 and a molecular weight of 338.45 g/mol. Its IUPAC name is 1-[(4R,12S,13R,16R,17S,18R,20S)-16-methyl-15-oxa-1,11-diazahexacyclo[15.3.1.04,12.04,20.05,10.013,18]henicosa-5,7,9-trien-11-yl]ethanone.
| Compound Name | 1-[(4R,12S,13R,16R,17S,18R,20S)-16-methyl-15-oxa-1,11-diazahexacyclo[15.3.1.04,12.04,20.05,10.013,18]henicosa-5,7,9-trien-11-yl]ethanone |
|---|---|
| PubChem CID | 162902841 |
| Molecular Formula | C21H26N2O2 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | 1-[(4R,12S,13R,16R,17S,18R,20S)-16-methyl-15-oxa-1,11-diazahexacyclo[15.3.1.04,12.04,20.05,10.013,18]henicosa-5,7,9-trien-11-yl]ethanone |
| SMILES | CC(=O)N1c2ccccc2[C@]23CCN4C[C@@H]5[C@H](C[C@H]42)[C@@H](CO[C@@H]5C)[C@H]13 |
| InChI | InChI=1S/C21H26N2O2/c1-12-15-10-22-8-7-21-17-5-3-4-6-18(17)23(13(2)24)20(21)16(11-25-12)14(15)9-19(21)22/h3-6,12,14-16,19-20H,7-11H2,1-2H3/t12-,14+,15+,16-,19+,20+,21-/m1/s1 |
| InChIKey | BYQCMXYHBHKSQD-IULLBQDFSA-N |
| XLogP | 2.42 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |