C15H14O4 — CID 162903166
(1R)-3,8-dimethyl-5,14-dioxatricyclo[10.2.1.02,6]pentadeca-2,6,8,12(15)-tetraene-4,13-dione (PubChem CID 162903166) has the molecular formula C15H14O4 and a molecular weight of 258.27 g/mol. Its IUPAC name is (1R)-3,8-dimethyl-5,14-dioxatricyclo[10.2.1.02,6]pentadeca-2,6,8,12(15)-tetraene-4,13-dione.
| Compound Name | (1R)-3,8-dimethyl-5,14-dioxatricyclo[10.2.1.02,6]pentadeca-2,6,8,12(15)-tetraene-4,13-dione |
|---|---|
| PubChem CID | 162903166 |
| Molecular Formula | C15H14O4 |
| Molecular Weight | 258.27 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | (1R)-3,8-dimethyl-5,14-dioxatricyclo[10.2.1.02,6]pentadeca-2,6,8,12(15)-tetraene-4,13-dione |
| SMILES | CC1=CCCC2=C[C@@H](OC2=O)C2=C(C)C(=O)OC2=C1 |
| InChI | InChI=1S/C15H14O4/c1-8-4-3-5-10-7-12(19-15(10)17)13-9(2)14(16)18-11(13)6-8/h4,6-7,12H,3,5H2,1-2H3/t12-/m1/s1 |
| InChIKey | ALHPETDJKFISPE-GFCCVEGCSA-N |
| XLogP | 2.34 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.27 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |