C29H46O3 — CID 162903453
(5S,8S,9S,10R,11R,13R,14S,17R)-17-[(E,2R,5S)-5-ethyl-6-methylhept-3-en-2-yl]-11-hydroxy-10,13-dimethyl-2,4,5,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,6-dione (PubChem CID 162903453) has the molecular formula C29H46O3 and a molecular weight of 442.68 g/mol. Its IUPAC name is (5S,8S,9S,10R,11R,13R,14S,17R)-17-[(E,2R,5S)-5-ethyl-6-methylhept-3-en-2-yl]-11-hydroxy-10,13-dimethyl-2,4,5,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,6-dione.
| Compound Name | (5S,8S,9S,10R,11R,13R,14S,17R)-17-[(E,2R,5S)-5-ethyl-6-methylhept-3-en-2-yl]-11-hydroxy-10,13-dimethyl-2,4,5,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,6-dione |
|---|---|
| PubChem CID | 162903453 |
| Molecular Formula | C29H46O3 |
| Molecular Weight | 442.68 g/mol |
| Exact Mass | 442.34 |
| IUPAC Name | (5S,8S,9S,10R,11R,13R,14S,17R)-17-[(E,2R,5S)-5-ethyl-6-methylhept-3-en-2-yl]-11-hydroxy-10,13-dimethyl-2,4,5,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,6-dione |
| SMILES | CC[C@H](/C=C/[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC(=O)[C@H]4CC(=O)CC[C@]4(C)[C@H]3[C@H](O)C[C@]12C)C(C)C |
| InChI | InChI=1S/C29H46O3/c1-7-19(17(2)3)9-8-18(4)22-10-11-23-21-15-25(31)24-14-20(30)12-13-28(24,5)27(21)26(32)16-29(22,23)6/h8-9,17-19,21-24,26-27,32H,7,10-16H2,1-6H3/b9-8+/t18-,19-,21+,22-,23+,24-,26-,27-,28+,29-/m1/s1 |
| InChIKey | HSSRDENIUYAQMO-LJSCIHPNSA-N |
| XLogP | 6.24 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.68 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|