C20H30O4 — CID 162903549
(2R,4R,5S,7S,8R,10S)-7,10-dihydroxy-5-methyl-8-[(2S)-6-methylhept-5-en-2-yl]-11-oxatricyclo[7.3.0.02,4]dodec-1(9)-en-12-one (PubChem CID 162903549) has the molecular formula C20H30O4 and a molecular weight of 334.46 g/mol. Its IUPAC name is (2R,4R,5S,7S,8R,10S)-7,10-dihydroxy-5-methyl-8-[(2S)-6-methylhept-5-en-2-yl]-11-oxatricyclo[7.3.0.02,4]dodec-1(9)-en-12-one.
| Compound Name | (2R,4R,5S,7S,8R,10S)-7,10-dihydroxy-5-methyl-8-[(2S)-6-methylhept-5-en-2-yl]-11-oxatricyclo[7.3.0.02,4]dodec-1(9)-en-12-one |
|---|---|
| PubChem CID | 162903549 |
| Molecular Formula | C20H30O4 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | (2R,4R,5S,7S,8R,10S)-7,10-dihydroxy-5-methyl-8-[(2S)-6-methylhept-5-en-2-yl]-11-oxatricyclo[7.3.0.02,4]dodec-1(9)-en-12-one |
| SMILES | CC(C)=CCC[C@H](C)[C@@H]1C2=C(C(=O)O[C@@H]2O)[C@@H]2C[C@@H]2[C@@H](C)C[C@@H]1O |
| InChI | InChI=1S/C20H30O4/c1-10(2)6-5-7-11(3)16-15(21)8-12(4)13-9-14(13)17-18(16)20(23)24-19(17)22/h6,11-16,20-21,23H,5,7-9H2,1-4H3/t11-,12-,13+,14+,15-,16-,20-/m0/s1 |
| InChIKey | MEWJIELOGQNETM-BBYBEKIYSA-N |
| XLogP | 3.19 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|