C24H34O4 — CID 162903611
[2-(3,7-dimethylocta-2,6-dienyl)-5-hexyl-3,6-dioxocyclohexa-1,4-dien-1-yl] acetate (PubChem CID 162903611) has the molecular formula C24H34O4 and a molecular weight of 386.53 g/mol. Its IUPAC name is [2-(3,7-dimethylocta-2,6-dienyl)-5-hexyl-3,6-dioxocyclohexa-1,4-dien-1-yl] acetate.
| Compound Name | [2-(3,7-dimethylocta-2,6-dienyl)-5-hexyl-3,6-dioxocyclohexa-1,4-dien-1-yl] acetate |
|---|---|
| PubChem CID | 162903611 |
| Molecular Formula | C24H34O4 |
| Molecular Weight | 386.53 g/mol |
| Exact Mass | 386.25 |
| IUPAC Name | [2-(3,7-dimethylocta-2,6-dienyl)-5-hexyl-3,6-dioxocyclohexa-1,4-dien-1-yl] acetate |
| SMILES | CCCCCCC1=CC(=O)C(CC=C(C)CCC=C(C)C)=C(OC(C)=O)C1=O |
| InChI | InChI=1S/C24H34O4/c1-6-7-8-9-13-20-16-22(26)21(24(23(20)27)28-19(5)25)15-14-18(4)12-10-11-17(2)3/h11,14,16H,6-10,12-13,15H2,1-5H3 |
| InChIKey | JSVCHTXKUKVLEG-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.53 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|