C15H22O4 — CID 162903908
(1S,2S,4R,7E,10S,11R,12S)-10-hydroxy-4,8,12-trimethyl-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-13-one (PubChem CID 162903908) has the molecular formula C15H22O4 and a molecular weight of 266.34 g/mol. Its IUPAC name is (1S,2S,4R,7E,10S,11R,12S)-10-hydroxy-4,8,12-trimethyl-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-13-one.
| Compound Name | (1S,2S,4R,7E,10S,11R,12S)-10-hydroxy-4,8,12-trimethyl-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-13-one |
|---|---|
| PubChem CID | 162903908 |
| Molecular Formula | C15H22O4 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | (1S,2S,4R,7E,10S,11R,12S)-10-hydroxy-4,8,12-trimethyl-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-13-one |
| SMILES | C/C1=C\CC[C@@]2(C)O[C@H]2[C@H]2OC(=O)[C@@H](C)[C@@H]2[C@@H](O)C1 |
| InChI | InChI=1S/C15H22O4/c1-8-5-4-6-15(3)13(19-15)12-11(10(16)7-8)9(2)14(17)18-12/h5,9-13,16H,4,6-7H2,1-3H3/b8-5+/t9-,10-,11+,12-,13-,15+/m0/s1 |
| InChIKey | AAROMMBBIIRPFB-GLOMIPSOSA-N |
| XLogP | 1.81 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|