C15H22BrClO — CID 162904010
(6R,8S,9R,11S)-8-bromo-9-chloro-5,5,9-trimethyl-1-methylidenespiro[5.5]undec-3-en-11-ol (PubChem CID 162904010) has the molecular formula C15H22BrClO and a molecular weight of 333.70 g/mol. Its IUPAC name is (6R,8S,9R,11S)-8-bromo-9-chloro-5,5,9-trimethyl-1-methylidenespiro[5.5]undec-3-en-11-ol.
| Compound Name | (6R,8S,9R,11S)-8-bromo-9-chloro-5,5,9-trimethyl-1-methylidenespiro[5.5]undec-3-en-11-ol |
|---|---|
| PubChem CID | 162904010 |
| Molecular Formula | C15H22BrClO |
| Molecular Weight | 333.70 g/mol |
| Exact Mass | 332.05 |
| IUPAC Name | (6R,8S,9R,11S)-8-bromo-9-chloro-5,5,9-trimethyl-1-methylidenespiro[5.5]undec-3-en-11-ol |
| SMILES | C=C1CC=CC(C)(C)[C@@]12C[C@H](Br)[C@](C)(Cl)C[C@@H]2O |
| InChI | InChI=1S/C15H22BrClO/c1-10-6-5-7-13(2,3)15(10)8-11(16)14(4,17)9-12(15)18/h5,7,11-12,18H,1,6,8-9H2,2-4H3/t11-,12-,14+,15-/m0/s1 |
| InChIKey | QSMNBYDYMWRZTN-VIRABCJISA-N |
| XLogP | 4.43 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.70 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|