C19H28O3S — CID 162904226
[(2R,4S,4aR,8aR)-4,4a-dimethyl-7-oxo-6-propan-2-ylidene-2,3,4,5,8,8a-hexahydro-1H-naphthalen-2-yl] (Z)-4-sulfanylbut-2-enoate (PubChem CID 162904226) has the molecular formula C19H28O3S and a molecular weight of 336.50 g/mol. Its IUPAC name is [(2R,4S,4aR,8aR)-4,4a-dimethyl-7-oxo-6-propan-2-ylidene-2,3,4,5,8,8a-hexahydro-1H-naphthalen-2-yl] (Z)-4-sulfanylbut-2-enoate.
| Compound Name | [(2R,4S,4aR,8aR)-4,4a-dimethyl-7-oxo-6-propan-2-ylidene-2,3,4,5,8,8a-hexahydro-1H-naphthalen-2-yl] (Z)-4-sulfanylbut-2-enoate |
|---|---|
| PubChem CID | 162904226 |
| Molecular Formula | C19H28O3S |
| Molecular Weight | 336.50 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | [(2R,4S,4aR,8aR)-4,4a-dimethyl-7-oxo-6-propan-2-ylidene-2,3,4,5,8,8a-hexahydro-1H-naphthalen-2-yl] (Z)-4-sulfanylbut-2-enoate |
| SMILES | CC(C)=C1C[C@@]2(C)[C@@H](CC1=O)C[C@H](OC(=O)/C=C\CS)C[C@@H]2C |
| InChI | InChI=1S/C19H28O3S/c1-12(2)16-11-19(4)13(3)8-15(9-14(19)10-17(16)20)22-18(21)6-5-7-23/h5-6,13-15,23H,7-11H2,1-4H3/b6-5-/t13-,14+,15+,19+/m0/s1 |
| InChIKey | UJGGTPOZNYWRBS-SYDGSADOSA-N |
| XLogP | 4.14 |
| TPSA | 43.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.50 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|