C31H35NO7 — CID 162904377
2-cyclopentyloxy-8,16-dihydroxy-19-[4-(hydroxyamino)phenyl]-8-methyl-10,14-dioxapentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1,3(11),12,15(20)-tetraen-21-one (PubChem CID 162904377) has the molecular formula C31H35NO7 and a molecular weight of 533.62 g/mol. Its IUPAC name is 2-cyclopentyloxy-8,16-dihydroxy-19-[4-(hydroxyamino)phenyl]-8-methyl-10,14-dioxapentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1,3(11),12,15(20)-tetraen-21-one.
| Compound Name | 2-cyclopentyloxy-8,16-dihydroxy-19-[4-(hydroxyamino)phenyl]-8-methyl-10,14-dioxapentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1,3(11),12,15(20)-tetraen-21-one |
|---|---|
| PubChem CID | 162904377 |
| Molecular Formula | C31H35NO7 |
| Molecular Weight | 533.62 g/mol |
| Exact Mass | 533.24 |
| IUPAC Name | 2-cyclopentyloxy-8,16-dihydroxy-19-[4-(hydroxyamino)phenyl]-8-methyl-10,14-dioxapentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1,3(11),12,15(20)-tetraen-21-one |
| SMILES | CC1(O)CCCC2c3c(cc4oc5c(c(=O)c4c3OC3CCCC3)C(c3ccc(NO)cc3)CCC5O)OC21 |
| InChI | InChI=1S/C31H35NO7/c1-31(35)14-4-7-20-24-22(39-30(20)31)15-23-26(29(24)37-18-5-2-3-6-18)27(34)25-19(12-13-21(33)28(25)38-23)16-8-10-17(32-36)11-9-16/h8-11,15,18-21,30,32-33,35-36H,2-7,12-14H2,1H3 |
| InChIKey | KVLFVMYTAUVXSD-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 121.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.62 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|