C24H32O3 — CID 162904380
3-[5-(2H-chromen-7-yloxy)-3-methylpent-3-enyl]-2,2,4-trimethylcyclohex-3-en-1-ol (PubChem CID 162904380) has the molecular formula C24H32O3 and a molecular weight of 368.52 g/mol. Its IUPAC name is 3-[5-(2H-chromen-7-yloxy)-3-methylpent-3-enyl]-2,2,4-trimethylcyclohex-3-en-1-ol.
| Compound Name | 3-[5-(2H-chromen-7-yloxy)-3-methylpent-3-enyl]-2,2,4-trimethylcyclohex-3-en-1-ol |
|---|---|
| PubChem CID | 162904380 |
| Molecular Formula | C24H32O3 |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.24 |
| IUPAC Name | 3-[5-(2H-chromen-7-yloxy)-3-methylpent-3-enyl]-2,2,4-trimethylcyclohex-3-en-1-ol |
| SMILES | CC(=CCOc1ccc2c(c1)OCC=C2)CCC1=C(C)CCC(O)C1(C)C |
| InChI | InChI=1S/C24H32O3/c1-17(7-11-21-18(2)8-12-23(25)24(21,3)4)13-15-26-20-10-9-19-6-5-14-27-22(19)16-20/h5-6,9-10,13,16,23,25H,7-8,11-12,14-15H2,1-4H3 |
| InChIKey | YZRYPZNIUFMRAE-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|