C22H38O5 — CID 162904747
[(E,2Z,6R,7S)-7,10-dihydroxy-2-[(E)-6-hydroxy-4-methylhex-4-enylidene]-6,10-dimethylundec-8-enyl] acetate (PubChem CID 162904747) has the molecular formula C22H38O5 and a molecular weight of 382.54 g/mol. Its IUPAC name is [(E,2Z,6R,7S)-7,10-dihydroxy-2-[(E)-6-hydroxy-4-methylhex-4-enylidene]-6,10-dimethylundec-8-enyl] acetate.
| Compound Name | [(E,2Z,6R,7S)-7,10-dihydroxy-2-[(E)-6-hydroxy-4-methylhex-4-enylidene]-6,10-dimethylundec-8-enyl] acetate |
|---|---|
| PubChem CID | 162904747 |
| Molecular Formula | C22H38O5 |
| Molecular Weight | 382.54 g/mol |
| Exact Mass | 382.27 |
| IUPAC Name | [(E,2Z,6R,7S)-7,10-dihydroxy-2-[(E)-6-hydroxy-4-methylhex-4-enylidene]-6,10-dimethylundec-8-enyl] acetate |
| SMILES | CC(=O)OC/C(=C\CC/C(C)=C/CO)CCC[C@@H](C)[C@H](O)/C=C/C(C)(C)O |
| InChI | InChI=1S/C22H38O5/c1-17(13-15-23)8-6-10-20(16-27-19(3)24)11-7-9-18(2)21(25)12-14-22(4,5)26/h10,12-14,18,21,23,25-26H,6-9,11,15-16H2,1-5H3/b14-12+,17-13+,20-10-/t18-,21-/m1/s1 |
| InChIKey | ROCCQXPZHZBUAS-AKKIEULCSA-N |
| XLogP | 3.69 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.54 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|