C15H27N3O4 — CID 162904879
4-(2-methoxyethoxymethyl)-4-[[(1-methylpyrazol-4-yl)methylamino]methyl]cyclopentane-1,2-diol (PubChem CID 162904879) has the molecular formula C15H27N3O4 and a molecular weight of 313.40 g/mol. Its IUPAC name is 4-(2-methoxyethoxymethyl)-4-[[(1-methylpyrazol-4-yl)methylamino]methyl]cyclopentane-1,2-diol.
| Compound Name | 4-(2-methoxyethoxymethyl)-4-[[(1-methylpyrazol-4-yl)methylamino]methyl]cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 162904879 |
| Molecular Formula | C15H27N3O4 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.20 |
| IUPAC Name | 4-(2-methoxyethoxymethyl)-4-[[(1-methylpyrazol-4-yl)methylamino]methyl]cyclopentane-1,2-diol |
| SMILES | COCCOCC1(CNCc2cnn(C)c2)CC(O)C(O)C1 |
| InChI | InChI=1S/C15H27N3O4/c1-18-9-12(8-17-18)7-16-10-15(11-22-4-3-21-2)5-13(19)14(20)6-15/h8-9,13-14,16,19-20H,3-7,10-11H2,1-2H3 |
| InChIKey | UMTOIGWHLHNJDL-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 88.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|