C19H18O9 — CID 162904931
2-[3,4-dihydroxy-6-(hydroxymethyl)oxan-2-yl]-3,6,7-trihydroxyxanthen-9-one (PubChem CID 162904931) has the molecular formula C19H18O9 and a molecular weight of 390.34 g/mol. Its IUPAC name is 2-[3,4-dihydroxy-6-(hydroxymethyl)oxan-2-yl]-3,6,7-trihydroxyxanthen-9-one.
| Compound Name | 2-[3,4-dihydroxy-6-(hydroxymethyl)oxan-2-yl]-3,6,7-trihydroxyxanthen-9-one |
|---|---|
| PubChem CID | 162904931 |
| Molecular Formula | C19H18O9 |
| Molecular Weight | 390.34 g/mol |
| Exact Mass | 390.10 |
| IUPAC Name | 2-[3,4-dihydroxy-6-(hydroxymethyl)oxan-2-yl]-3,6,7-trihydroxyxanthen-9-one |
| SMILES | O=c1c2cc(O)c(O)cc2oc2cc(O)c(C3OC(CO)CC(O)C3O)cc12 |
| InChI | InChI=1S/C19H18O9/c20-6-7-1-14(24)18(26)19(27-7)8-2-9-15(4-11(8)21)28-16-5-13(23)12(22)3-10(16)17(9)25/h2-5,7,14,18-24,26H,1,6H2 |
| InChIKey | DBQUJAQZCBFIQW-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 160.82 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.34 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|