C22H32O15 — CID 162904984
[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] 7-(hydroxymethyl)-1-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,4a,5,6-tetrahydrocyclopenta[c]pyran-4-carboxylate (PubChem CID 162904984) has the molecular formula C22H32O15 and a molecular weight of 536.48 g/mol. Its IUPAC name is [3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] 7-(hydroxymethyl)-1-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,4a,5,6-tetrahydrocyclopenta[c]pyran-4-carboxylate.
| Compound Name | [3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] 7-(hydroxymethyl)-1-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,4a,5,6-tetrahydrocyclopenta[c]pyran-4-carboxylate |
|---|---|
| PubChem CID | 162904984 |
| Molecular Formula | C22H32O15 |
| Molecular Weight | 536.48 g/mol |
| Exact Mass | 536.17 |
| IUPAC Name | [3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] 7-(hydroxymethyl)-1-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,4a,5,6-tetrahydrocyclopenta[c]pyran-4-carboxylate |
| SMILES | O=C(OC1OC(CO)C(O)C(O)C1O)C1=COC(OC2OC(CO)C(O)C(O)C2O)C2=C(CO)CCC12 |
| InChI | InChI=1S/C22H32O15/c23-3-7-1-2-8-9(19(32)36-21-17(30)15(28)13(26)10(4-24)34-21)6-33-20(12(7)8)37-22-18(31)16(29)14(27)11(5-25)35-22/h6,8,10-11,13-18,20-31H,1-5H2 |
| InChIKey | SEGOLFFQSLSMCU-UHFFFAOYSA-N |
| XLogP | -4.91 |
| TPSA | 245.29 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.48 |
| LogP ≤ 5 | -4.91 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|