C20H17NO8 — CID 162905004
2-[3-(3-amino-3-oxopropanoyl)-4,5,9-trihydroxy-9-methyl-10-oxoanthracen-2-yl]acetic acid (PubChem CID 162905004) has the molecular formula C20H17NO8 and a molecular weight of 399.36 g/mol. Its IUPAC name is 2-[3-(3-amino-3-oxopropanoyl)-4,5,9-trihydroxy-9-methyl-10-oxoanthracen-2-yl]acetic acid.
| Compound Name | 2-[3-(3-amino-3-oxopropanoyl)-4,5,9-trihydroxy-9-methyl-10-oxoanthracen-2-yl]acetic acid |
|---|---|
| PubChem CID | 162905004 |
| Molecular Formula | C20H17NO8 |
| Molecular Weight | 399.36 g/mol |
| Exact Mass | 399.10 |
| IUPAC Name | 2-[3-(3-amino-3-oxopropanoyl)-4,5,9-trihydroxy-9-methyl-10-oxoanthracen-2-yl]acetic acid |
| SMILES | CC1(O)c2cccc(O)c2C(=O)c2c1cc(CC(=O)O)c(C(=O)CC(N)=O)c2O |
| InChI | InChI=1S/C20H17NO8/c1-20(29)9-3-2-4-11(22)16(9)19(28)17-10(20)5-8(6-14(25)26)15(18(17)27)12(23)7-13(21)24/h2-5,22,27,29H,6-7H2,1H3,(H2,21,24)(H,25,26) |
| InChIKey | FQQGCQLSPNJAHW-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 175.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.36 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|