C25H40O6 — CID 162905011
4-O-[[(4aS,7R,8S,8aR)-8-[(3R)-4-methoxy-3-methyl-4-oxobutyl]-4,7,8-trimethyl-1,2,5,6,7,8a-hexahydronaphthalen-4a-yl]methyl] 1-O-methyl butanedioate (PubChem CID 162905011) has the molecular formula C25H40O6 and a molecular weight of 436.59 g/mol. Its IUPAC name is 4-O-[[(4aS,7R,8S,8aR)-8-[(3R)-4-methoxy-3-methyl-4-oxobutyl]-4,7,8-trimethyl-1,2,5,6,7,8a-hexahydronaphthalen-4a-yl]methyl] 1-O-methyl butanedioate.
| Compound Name | 4-O-[[(4aS,7R,8S,8aR)-8-[(3R)-4-methoxy-3-methyl-4-oxobutyl]-4,7,8-trimethyl-1,2,5,6,7,8a-hexahydronaphthalen-4a-yl]methyl] 1-O-methyl butanedioate |
|---|---|
| PubChem CID | 162905011 |
| Molecular Formula | C25H40O6 |
| Molecular Weight | 436.59 g/mol |
| Exact Mass | 436.28 |
| IUPAC Name | 4-O-[[(4aS,7R,8S,8aR)-8-[(3R)-4-methoxy-3-methyl-4-oxobutyl]-4,7,8-trimethyl-1,2,5,6,7,8a-hexahydronaphthalen-4a-yl]methyl] 1-O-methyl butanedioate |
| SMILES | COC(=O)CCC(=O)OC[C@@]12CC[C@@H](C)[C@](C)(CC[C@@H](C)C(=O)OC)[C@H]1CCC=C2C |
| InChI | InChI=1S/C25H40O6/c1-17(23(28)30-6)12-14-24(4)18(2)13-15-25(19(3)8-7-9-20(24)25)16-31-22(27)11-10-21(26)29-5/h8,17-18,20H,7,9-16H2,1-6H3/t17-,18-,20-,24+,25-/m1/s1 |
| InChIKey | LFPNFHFVASKHJS-RLFCIGJUSA-N |
| XLogP | 4.85 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.59 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|