C15H28O2 — CID 162905306
(E,2S,5R)-7-[(2S)-2-methyloxolan-2-yl]-5-propan-2-ylhept-6-en-2-ol (PubChem CID 162905306) has the molecular formula C15H28O2 and a molecular weight of 240.39 g/mol. Its IUPAC name is (E,2S,5R)-7-[(2S)-2-methyloxolan-2-yl]-5-propan-2-ylhept-6-en-2-ol.
| Compound Name | (E,2S,5R)-7-[(2S)-2-methyloxolan-2-yl]-5-propan-2-ylhept-6-en-2-ol |
|---|---|
| PubChem CID | 162905306 |
| Molecular Formula | C15H28O2 |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.21 |
| IUPAC Name | (E,2S,5R)-7-[(2S)-2-methyloxolan-2-yl]-5-propan-2-ylhept-6-en-2-ol |
| SMILES | CC(C)[C@H](/C=C/[C@]1(C)CCCO1)CC[C@H](C)O |
| InChI | InChI=1S/C15H28O2/c1-12(2)14(7-6-13(3)16)8-10-15(4)9-5-11-17-15/h8,10,12-14,16H,5-7,9,11H2,1-4H3/b10-8+/t13-,14-,15-/m0/s1 |
| InChIKey | YOMJFGRYEWDLQO-XACVDLTFSA-N |
| XLogP | 3.54 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|