C19H30O6 — CID 162905960
(2R)-4-hydroxy-2-[(2R,3R,4S,5E,7S,8R,9E)-2,4,8-trihydroxy-3,7,9-trimethylundeca-5,9-dienyl]-2,3-dihydropyran-6-one (PubChem CID 162905960) has the molecular formula C19H30O6 and a molecular weight of 354.44 g/mol. Its IUPAC name is (2R)-4-hydroxy-2-[(2R,3R,4S,5E,7S,8R,9E)-2,4,8-trihydroxy-3,7,9-trimethylundeca-5,9-dienyl]-2,3-dihydropyran-6-one.
| Compound Name | (2R)-4-hydroxy-2-[(2R,3R,4S,5E,7S,8R,9E)-2,4,8-trihydroxy-3,7,9-trimethylundeca-5,9-dienyl]-2,3-dihydropyran-6-one |
|---|---|
| PubChem CID | 162905960 |
| Molecular Formula | C19H30O6 |
| Molecular Weight | 354.44 g/mol |
| Exact Mass | 354.20 |
| IUPAC Name | (2R)-4-hydroxy-2-[(2R,3R,4S,5E,7S,8R,9E)-2,4,8-trihydroxy-3,7,9-trimethylundeca-5,9-dienyl]-2,3-dihydropyran-6-one |
| SMILES | C/C=C(\C)[C@H](O)[C@@H](C)/C=C/[C@H](O)[C@H](C)[C@H](O)C[C@@H]1CC(O)=CC(=O)O1 |
| InChI | InChI=1S/C19H30O6/c1-5-11(2)19(24)12(3)6-7-16(21)13(4)17(22)10-15-8-14(20)9-18(23)25-15/h5-7,9,12-13,15-17,19-22,24H,8,10H2,1-4H3/b7-6+,11-5+/t12-,13-,15-,16-,17+,19-/m0/s1 |
| InChIKey | DPLVZZAZGYXULT-RVUFUSTHSA-N |
| XLogP | 2.01 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.44 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|