C20H28O3 — CID 162905992
(1Z,4S,6S,12S,15S)-4,12-dimethyl-9-methylidene-15-propan-2-yl-5-oxatricyclo[10.3.0.04,6]pentadec-1-ene-10,14-dione (PubChem CID 162905992) has the molecular formula C20H28O3 and a molecular weight of 316.44 g/mol. Its IUPAC name is (1Z,4S,6S,12S,15S)-4,12-dimethyl-9-methylidene-15-propan-2-yl-5-oxatricyclo[10.3.0.04,6]pentadec-1-ene-10,14-dione.
| Compound Name | (1Z,4S,6S,12S,15S)-4,12-dimethyl-9-methylidene-15-propan-2-yl-5-oxatricyclo[10.3.0.04,6]pentadec-1-ene-10,14-dione |
|---|---|
| PubChem CID | 162905992 |
| Molecular Formula | C20H28O3 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | (1Z,4S,6S,12S,15S)-4,12-dimethyl-9-methylidene-15-propan-2-yl-5-oxatricyclo[10.3.0.04,6]pentadec-1-ene-10,14-dione |
| SMILES | C=C1CC[C@@H]2O[C@@]2(C)C/C=C2/[C@H](C(C)C)C(=O)C[C@@]2(C)CC1=O |
| InChI | InChI=1S/C20H28O3/c1-12(2)18-14-8-9-20(5)17(23-20)7-6-13(3)15(21)10-19(14,4)11-16(18)22/h8,12,17-18H,3,6-7,9-11H2,1-2,4-5H3/b14-8-/t17-,18-,19+,20-/m0/s1 |
| InChIKey | VRQFTDZLAVZHMF-GUIBPOCESA-N |
| XLogP | 4.02 |
| TPSA | 46.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|