C20H30O — CID 162906704
[(4bR,8aS)-1-ethyl-4b,8,8-trimethyl-5,6,7,8a,9,10-hexahydrophenanthren-2-yl]methanol (PubChem CID 162906704) has the molecular formula C20H30O and a molecular weight of 286.46 g/mol. Its IUPAC name is [(4bR,8aS)-1-ethyl-4b,8,8-trimethyl-5,6,7,8a,9,10-hexahydrophenanthren-2-yl]methanol.
| Compound Name | [(4bR,8aS)-1-ethyl-4b,8,8-trimethyl-5,6,7,8a,9,10-hexahydrophenanthren-2-yl]methanol |
|---|---|
| PubChem CID | 162906704 |
| Molecular Formula | C20H30O |
| Molecular Weight | 286.46 g/mol |
| Exact Mass | 286.23 |
| IUPAC Name | [(4bR,8aS)-1-ethyl-4b,8,8-trimethyl-5,6,7,8a,9,10-hexahydrophenanthren-2-yl]methanol |
| SMILES | CCc1c(CO)ccc2c1CC[C@H]1C(C)(C)CCC[C@@]21C |
| InChI | InChI=1S/C20H30O/c1-5-15-14(13-21)7-9-17-16(15)8-10-18-19(2,3)11-6-12-20(17,18)4/h7,9,18,21H,5-6,8,10-13H2,1-4H3/t18-,20-/m0/s1 |
| InChIKey | PUZFEMFUMHPTLQ-ICSRJNTNSA-N |
| XLogP | 4.77 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.46 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |