C20H33N3 — CID 162907017
(1S,2S,9S,10R)-1-[(2R)-piperidin-2-yl]-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-ene (PubChem CID 162907017) has the molecular formula C20H33N3 and a molecular weight of 315.51 g/mol. Its IUPAC name is (1S,2S,9S,10R)-1-[(2R)-piperidin-2-yl]-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-ene.
| Compound Name | (1S,2S,9S,10R)-1-[(2R)-piperidin-2-yl]-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-ene |
|---|---|
| PubChem CID | 162907017 |
| Molecular Formula | C20H33N3 |
| Molecular Weight | 315.51 g/mol |
| Exact Mass | 315.27 |
| IUPAC Name | (1S,2S,9S,10R)-1-[(2R)-piperidin-2-yl]-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-ene |
| SMILES | C1=C2CCCN[C@@H]2[C@@]2([C@H]3CCCCN3)C[C@@H]1[C@H]1CCCCN1C2 |
| InChI | InChI=1S/C20H33N3/c1-3-9-21-18(8-1)20-13-16(12-15-6-5-10-22-19(15)20)17-7-2-4-11-23(17)14-20/h12,16-19,21-22H,1-11,13-14H2/t16-,17-,18-,19+,20+/m1/s1 |
| InChIKey | BVSPPBKONISENN-UEDWAMCQSA-N |
| XLogP | 2.68 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.51 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|