C20H36O4 — CID 162907127
(3S,7R)-3,7-dimethyl-8-[(Z)-3-methylnon-2-enoyl]oxyoctanoic acid (PubChem CID 162907127) has the molecular formula C20H36O4 and a molecular weight of 340.50 g/mol. Its IUPAC name is (3S,7R)-3,7-dimethyl-8-[(Z)-3-methylnon-2-enoyl]oxyoctanoic acid.
| Compound Name | (3S,7R)-3,7-dimethyl-8-[(Z)-3-methylnon-2-enoyl]oxyoctanoic acid |
|---|---|
| PubChem CID | 162907127 |
| Molecular Formula | C20H36O4 |
| Molecular Weight | 340.50 g/mol |
| Exact Mass | 340.26 |
| IUPAC Name | (3S,7R)-3,7-dimethyl-8-[(Z)-3-methylnon-2-enoyl]oxyoctanoic acid |
| SMILES | CCCCCC/C(C)=C\C(=O)OC[C@H](C)CCC[C@H](C)CC(=O)O |
| InChI | InChI=1S/C20H36O4/c1-5-6-7-8-10-17(3)14-20(23)24-15-18(4)12-9-11-16(2)13-19(21)22/h14,16,18H,5-13,15H2,1-4H3,(H,21,22)/b17-14-/t16-,18+/m0/s1 |
| InChIKey | HPMCDJQPMNPVHR-MJLVVAAFSA-N |
| XLogP | 5.36 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.50 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|