C15H20O5 — CID 162907634
(1S,2S,4R,6S,9R,10R,13S)-4,9-dimethyl-3,7,15-trioxatetracyclo[11.2.1.02,4.06,10]hexadecane-8,14-dione (PubChem CID 162907634) has the molecular formula C15H20O5 and a molecular weight of 280.32 g/mol. Its IUPAC name is (1S,2S,4R,6S,9R,10R,13S)-4,9-dimethyl-3,7,15-trioxatetracyclo[11.2.1.02,4.06,10]hexadecane-8,14-dione.
| Compound Name | (1S,2S,4R,6S,9R,10R,13S)-4,9-dimethyl-3,7,15-trioxatetracyclo[11.2.1.02,4.06,10]hexadecane-8,14-dione |
|---|---|
| PubChem CID | 162907634 |
| Molecular Formula | C15H20O5 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | (1S,2S,4R,6S,9R,10R,13S)-4,9-dimethyl-3,7,15-trioxatetracyclo[11.2.1.02,4.06,10]hexadecane-8,14-dione |
| SMILES | C[C@H]1C(=O)O[C@H]2C[C@@]3(C)O[C@H]3[C@@H]3C[C@H](CC[C@@H]21)C(=O)O3 |
| InChI | InChI=1S/C15H20O5/c1-7-9-4-3-8-5-10(18-14(8)17)12-15(2,20-12)6-11(9)19-13(7)16/h7-12H,3-6H2,1-2H3/t7-,8+,9-,10+,11+,12+,15-/m1/s1 |
| InChIKey | YOFBLNIXKZVLJD-NKMCMAPESA-N |
| XLogP | 1.44 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|