C20H25NO4 — CID 162907654
9,10-dihydroxy-6,6,9,12-tetramethyl-7,8,10,10a-tetrahydro-6aH-isochromeno[4,3-c]quinolin-11-one (PubChem CID 162907654) has the molecular formula C20H25NO4 and a molecular weight of 343.42 g/mol. Its IUPAC name is 9,10-dihydroxy-6,6,9,12-tetramethyl-7,8,10,10a-tetrahydro-6aH-isochromeno[4,3-c]quinolin-11-one.
| Compound Name | 9,10-dihydroxy-6,6,9,12-tetramethyl-7,8,10,10a-tetrahydro-6aH-isochromeno[4,3-c]quinolin-11-one |
|---|---|
| PubChem CID | 162907654 |
| Molecular Formula | C20H25NO4 |
| Molecular Weight | 343.42 g/mol |
| Exact Mass | 343.18 |
| IUPAC Name | 9,10-dihydroxy-6,6,9,12-tetramethyl-7,8,10,10a-tetrahydro-6aH-isochromeno[4,3-c]quinolin-11-one |
| SMILES | Cn1c(=O)c2c(c3ccccc31)OC(C)(C)C1CCC(C)(O)C(O)C21 |
| InChI | InChI=1S/C20H25NO4/c1-19(2)12-9-10-20(3,24)17(22)14(12)15-16(25-19)11-7-5-6-8-13(11)21(4)18(15)23/h5-8,12,14,17,22,24H,9-10H2,1-4H3 |
| InChIKey | ZEHIXFMWFRDDON-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.42 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |