C20H36O4 — CID 162907800
methyl (E,3R,4S,10S)-4,10-diethyl-3-hydroxy-6-methyl-8-oxotetradec-6-enoate (PubChem CID 162907800) has the molecular formula C20H36O4 and a molecular weight of 340.50 g/mol. Its IUPAC name is methyl (E,3R,4S,10S)-4,10-diethyl-3-hydroxy-6-methyl-8-oxotetradec-6-enoate.
| Compound Name | methyl (E,3R,4S,10S)-4,10-diethyl-3-hydroxy-6-methyl-8-oxotetradec-6-enoate |
|---|---|
| PubChem CID | 162907800 |
| Molecular Formula | C20H36O4 |
| Molecular Weight | 340.50 g/mol |
| Exact Mass | 340.26 |
| IUPAC Name | methyl (E,3R,4S,10S)-4,10-diethyl-3-hydroxy-6-methyl-8-oxotetradec-6-enoate |
| SMILES | CCCC[C@H](CC)CC(=O)/C=C(\C)C[C@H](CC)[C@H](O)CC(=O)OC |
| InChI | InChI=1S/C20H36O4/c1-6-9-10-16(7-2)13-18(21)12-15(4)11-17(8-3)19(22)14-20(23)24-5/h12,16-17,19,22H,6-11,13-14H2,1-5H3/b15-12+/t16-,17-,19+/m0/s1 |
| InChIKey | SZCLBXFHUKXOSA-YDRBQJQASA-N |
| XLogP | 4.45 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.50 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|