C28H44O2 — CID 162908348
6-(7-hydroxy-7,12,16-trimethyl-15-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl)hept-3-en-2-one (PubChem CID 162908348) has the molecular formula C28H44O2 and a molecular weight of 412.66 g/mol. Its IUPAC name is 6-(7-hydroxy-7,12,16-trimethyl-15-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl)hept-3-en-2-one.
| Compound Name | 6-(7-hydroxy-7,12,16-trimethyl-15-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl)hept-3-en-2-one |
|---|---|
| PubChem CID | 162908348 |
| Molecular Formula | C28H44O2 |
| Molecular Weight | 412.66 g/mol |
| Exact Mass | 412.33 |
| IUPAC Name | 6-(7-hydroxy-7,12,16-trimethyl-15-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl)hept-3-en-2-one |
| SMILES | CC(=O)C=CCC(C)C1CCC2(C)C3CCC4C(C)(O)CCCC45CC35CCC12C |
| InChI | InChI=1S/C28H44O2/c1-19(8-6-9-20(2)29)21-12-15-25(4)22-10-11-23-26(5,30)13-7-14-27(23)18-28(22,27)17-16-24(21,25)3/h6,9,19,21-23,30H,7-8,10-18H2,1-5H3 |
| InChIKey | PSBXVADAAHBKOP-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.66 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|