C14H20O4 — CID 162908382
[(E,2R)-1-[(2R)-6-oxo-2,3-dihydropyran-2-yl]hept-4-en-2-yl] acetate (PubChem CID 162908382) has the molecular formula C14H20O4 and a molecular weight of 252.31 g/mol. Its IUPAC name is [(E,2R)-1-[(2R)-6-oxo-2,3-dihydropyran-2-yl]hept-4-en-2-yl] acetate.
| Compound Name | [(E,2R)-1-[(2R)-6-oxo-2,3-dihydropyran-2-yl]hept-4-en-2-yl] acetate |
|---|---|
| PubChem CID | 162908382 |
| Molecular Formula | C14H20O4 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | [(E,2R)-1-[(2R)-6-oxo-2,3-dihydropyran-2-yl]hept-4-en-2-yl] acetate |
| SMILES | CC/C=C/C[C@H](C[C@H]1CC=CC(=O)O1)OC(C)=O |
| InChI | InChI=1S/C14H20O4/c1-3-4-5-7-12(17-11(2)15)10-13-8-6-9-14(16)18-13/h4-6,9,12-13H,3,7-8,10H2,1-2H3/b5-4+/t12-,13-/m1/s1 |
| InChIKey | YKAIEQJKNLRONE-IJWDBEHRSA-N |
| XLogP | 2.54 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|