C16H25NO3 — CID 162908593
(1R,2R,4R,6S,9S)-2,9-dihydroxy-4-methyl-13-azatetracyclo[7.7.0.01,6.02,13]hexadecan-8-one (PubChem CID 162908593) has the molecular formula C16H25NO3 and a molecular weight of 279.38 g/mol. Its IUPAC name is (1R,2R,4R,6S,9S)-2,9-dihydroxy-4-methyl-13-azatetracyclo[7.7.0.01,6.02,13]hexadecan-8-one.
| Compound Name | (1R,2R,4R,6S,9S)-2,9-dihydroxy-4-methyl-13-azatetracyclo[7.7.0.01,6.02,13]hexadecan-8-one |
|---|---|
| PubChem CID | 162908593 |
| Molecular Formula | C16H25NO3 |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.18 |
| IUPAC Name | (1R,2R,4R,6S,9S)-2,9-dihydroxy-4-methyl-13-azatetracyclo[7.7.0.01,6.02,13]hexadecan-8-one |
| SMILES | C[C@@H]1C[C@H]2CC(=O)[C@]3(O)CCCN4CCC[C@@]23[C@]4(O)C1 |
| InChI | InChI=1S/C16H25NO3/c1-11-8-12-9-13(18)15(19)5-3-7-17-6-2-4-14(12,15)16(17,20)10-11/h11-12,19-20H,2-10H2,1H3/t11-,12+,14-,15-,16-/m1/s1 |
| InChIKey | PBTGBPAHHPAEDR-UDUPFKKZSA-N |
| XLogP | 1.30 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |