C16H25NO2 — CID 162908907
(1R,2S,4R,6S,9R)-2-hydroxy-4-methyl-13-azatetracyclo[7.7.0.01,6.02,13]hexadecan-8-one (PubChem CID 162908907) has the molecular formula C16H25NO2 and a molecular weight of 263.38 g/mol. Its IUPAC name is (1R,2S,4R,6S,9R)-2-hydroxy-4-methyl-13-azatetracyclo[7.7.0.01,6.02,13]hexadecan-8-one.
| Compound Name | (1R,2S,4R,6S,9R)-2-hydroxy-4-methyl-13-azatetracyclo[7.7.0.01,6.02,13]hexadecan-8-one |
|---|---|
| PubChem CID | 162908907 |
| Molecular Formula | C16H25NO2 |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.19 |
| IUPAC Name | (1R,2S,4R,6S,9R)-2-hydroxy-4-methyl-13-azatetracyclo[7.7.0.01,6.02,13]hexadecan-8-one |
| SMILES | C[C@@H]1C[C@H]2CC(=O)[C@@H]3CCCN4CCC[C@@]23[C@@]4(O)C1 |
| InChI | InChI=1S/C16H25NO2/c1-11-8-12-9-14(18)13-4-2-6-17-7-3-5-15(12,13)16(17,19)10-11/h11-13,19H,2-10H2,1H3/t11-,12+,13+,15-,16+/m1/s1 |
| InChIKey | ZLMYGBDFISIGLH-GADBESIXSA-N |
| XLogP | 2.19 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |