C12H14N6O7 — CID 162908972
4-(2,3,4,5-tetrahydroxypentyl)-1,3-dihydroimidazo[4,5-g]pteridine-2,6,8-trione (PubChem CID 162908972) has the molecular formula C12H14N6O7 and a molecular weight of 354.28 g/mol. Its IUPAC name is 4-(2,3,4,5-tetrahydroxypentyl)-1,3-dihydroimidazo[4,5-g]pteridine-2,6,8-trione.
| Compound Name | 4-(2,3,4,5-tetrahydroxypentyl)-1,3-dihydroimidazo[4,5-g]pteridine-2,6,8-trione |
|---|---|
| PubChem CID | 162908972 |
| Molecular Formula | C12H14N6O7 |
| Molecular Weight | 354.28 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | 4-(2,3,4,5-tetrahydroxypentyl)-1,3-dihydroimidazo[4,5-g]pteridine-2,6,8-trione |
| SMILES | O=c1nc2n(CC(O)C(O)C(O)CO)c3[nH]c(=O)[nH]c3nc-2c(=O)[nH]1 |
| InChI | InChI=1S/C12H14N6O7/c19-2-4(21)6(22)3(20)1-18-8-5(10(23)17-12(25)15-8)13-7-9(18)16-11(24)14-7/h3-4,6,19-22H,1-2H2,(H2,14,16,24)(H,17,23,25) |
| InChIKey | MPELQCKXFOWBCQ-UHFFFAOYSA-N |
| XLogP | -4.32 |
| TPSA | 210.21 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.28 |
| LogP ≤ 5 | -4.32 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |