C31H50O2 — CID 162909070
methyl 3-[(3S,4S,5R,8R,9R,10R,13R,14R,15S)-4,9,10,13-tetramethyl-3,15-bis(prop-1-en-2-yl)-2,3,5,6,7,8,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-4-yl]propanoate (PubChem CID 162909070) has the molecular formula C31H50O2 and a molecular weight of 454.74 g/mol. Its IUPAC name is methyl 3-[(3S,4S,5R,8R,9R,10R,13R,14R,15S)-4,9,10,13-tetramethyl-3,15-bis(prop-1-en-2-yl)-2,3,5,6,7,8,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-4-yl]propanoate.
| Compound Name | methyl 3-[(3S,4S,5R,8R,9R,10R,13R,14R,15S)-4,9,10,13-tetramethyl-3,15-bis(prop-1-en-2-yl)-2,3,5,6,7,8,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-4-yl]propanoate |
|---|---|
| PubChem CID | 162909070 |
| Molecular Formula | C31H50O2 |
| Molecular Weight | 454.74 g/mol |
| Exact Mass | 454.38 |
| IUPAC Name | methyl 3-[(3S,4S,5R,8R,9R,10R,13R,14R,15S)-4,9,10,13-tetramethyl-3,15-bis(prop-1-en-2-yl)-2,3,5,6,7,8,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-4-yl]propanoate |
| SMILES | C=C(C)[C@H]1CC[C@]2(C)CC[C@]3(C)[C@H](CC[C@@H]4[C@@](C)(CCC(=O)OC)[C@H](C(=C)C)CC[C@]43C)[C@@H]12 |
| InChI | InChI=1S/C31H50O2/c1-20(2)22-12-15-28(5)18-19-30(7)24(27(22)28)10-11-25-29(6,16-14-26(32)33-9)23(21(3)4)13-17-31(25,30)8/h22-25,27H,1,3,10-19H2,2,4-9H3/t22-,23+,24-,25-,27-,28-,29+,30-,31-/m1/s1 |
| InChIKey | QSMKZPFEDLONIK-PZSOPSJPSA-N |
| XLogP | 8.37 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.74 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|