C36H45NO16 — CID 162909642
(19,21,22,24-tetraacetyloxy-18-hydroxy-3,13,14,25-tetramethyl-6,15-dioxo-2,5,16-trioxa-11-azapentacyclo[15.7.1.01,20.03,23.07,12]pentacosa-7(12),8,10-trien-20-yl)methyl acetate (PubChem CID 162909642) has the molecular formula C36H45NO16 and a molecular weight of 747.75 g/mol. Its IUPAC name is (19,21,22,24-tetraacetyloxy-18-hydroxy-3,13,14,25-tetramethyl-6,15-dioxo-2,5,16-trioxa-11-azapentacyclo[15.7.1.01,20.03,23.07,12]pentacosa-7(12),8,10-trien-20-yl)methyl acetate.
| Compound Name | (19,21,22,24-tetraacetyloxy-18-hydroxy-3,13,14,25-tetramethyl-6,15-dioxo-2,5,16-trioxa-11-azapentacyclo[15.7.1.01,20.03,23.07,12]pentacosa-7(12),8,10-trien-20-yl)methyl acetate |
|---|---|
| PubChem CID | 162909642 |
| Molecular Formula | C36H45NO16 |
| Molecular Weight | 747.75 g/mol |
| Exact Mass | 747.27 |
| IUPAC Name | (19,21,22,24-tetraacetyloxy-18-hydroxy-3,13,14,25-tetramethyl-6,15-dioxo-2,5,16-trioxa-11-azapentacyclo[15.7.1.01,20.03,23.07,12]pentacosa-7(12),8,10-trien-20-yl)methyl acetate |
| SMILES | CC(=O)OCC12C(OC(C)=O)C(O)C3OC(=O)C(C)C(C)c4ncccc4C(=O)OCC4(C)OC1(C3C)C(OC(C)=O)C4C(OC(C)=O)C2OC(C)=O |
| InChI | InChI=1S/C36H45NO16/c1-15-16(2)32(44)52-27-17(3)36-29(49-20(6)40)24(34(9,53-36)13-47-33(45)23-11-10-12-37-25(15)23)28(48-19(5)39)31(51-22(8)42)35(36,14-46-18(4)38)30(26(27)43)50-21(7)41/h10-12,15-17,24,26-31,43H,13-14H2,1-9H3 |
| InChIKey | AAKFZVDNTDPCNJ-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 226.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.75 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|