C15H24O3 — CID 162910036
(6S)-6-[(2R,5R)-2,5-dihydroxy-6-methylhept-6-en-2-yl]-3-methylcyclohex-2-en-1-one (PubChem CID 162910036) has the molecular formula C15H24O3 and a molecular weight of 252.35 g/mol. Its IUPAC name is (6S)-6-[(2R,5R)-2,5-dihydroxy-6-methylhept-6-en-2-yl]-3-methylcyclohex-2-en-1-one.
| Compound Name | (6S)-6-[(2R,5R)-2,5-dihydroxy-6-methylhept-6-en-2-yl]-3-methylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 162910036 |
| Molecular Formula | C15H24O3 |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | (6S)-6-[(2R,5R)-2,5-dihydroxy-6-methylhept-6-en-2-yl]-3-methylcyclohex-2-en-1-one |
| SMILES | C=C(C)[C@H](O)CC[C@@](C)(O)[C@@H]1CCC(C)=CC1=O |
| InChI | InChI=1S/C15H24O3/c1-10(2)13(16)7-8-15(4,18)12-6-5-11(3)9-14(12)17/h9,12-13,16,18H,1,5-8H2,2-4H3/t12-,13-,15-/m1/s1 |
| InChIKey | BAZXJCXQRPPOEK-UMVBOHGHSA-N |
| XLogP | 2.38 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|