About 2-[(3,3-difluoropyrrolidin-1-yl)methyl]-4-[(2-hydroxyphenyl)methylamino]oxolan-3-ol
2-[(3,3-difluoropyrrolidin-1-yl)methyl]-4-[(2-hydroxyphenyl)methylamino]oxolan-3-ol (PubChem CID 162910576) has the molecular formula C16H22F2N2O3
and a molecular weight of 328.36 g/mol. Its IUPAC name is 2-[(3,3-difluoropyrrolidin-1-yl)methyl]-4-[(2-hydroxyphenyl)methylamino]oxolan-3-ol.
Molecular Properties
| Compound Name | 2-[(3,3-difluoropyrrolidin-1-yl)methyl]-4-[(2-hydroxyphenyl)methylamino]oxolan-3-ol |
| PubChem CID | 162910576 |
| Molecular Formula | C16H22F2N2O3 |
| Molecular Weight | 328.36 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | 2-[(3,3-difluoropyrrolidin-1-yl)methyl]-4-[(2-hydroxyphenyl)methylamino]oxolan-3-ol |
| SMILES | Oc1ccccc1CNC1COC(CN2CCC(F)(F)C2)C1O |
| InChI | InChI=1S/C16H22F2N2O3/c17-16(18)5-6-20(10-16)8-14-15(22)12(9-23-14)19-7-11-3-1-2-4-13(11)21/h1-4,12,14-15,19,21-22H,5-10H2 |
| InChIKey | WLAXFJNVCPAIKE-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 64.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.36 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|
Analyze 2-[(3,3-difluoropyrrolidin-1-yl)methyl]-4-[(2-hydroxyphenyl)methylamino]oxolan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3,3-difluoropyrrolidin-1-yl)methyl]-4-[(2-hydroxyphenyl)methylamino]oxolan-3-ol?
The IUPAC name of 2-[(3,3-difluoropyrrolidin-1-yl)methyl]-4-[(2-hydroxyphenyl)methylamino]oxolan-3-ol (CID 162910576) is 2-[(3,3-difluoropyrrolidin-1-yl)methyl]-4-[(2-hydroxyphenyl)methylamino]oxolan-3-ol.
What is the SMILES notation for 2-[(3,3-difluoropyrrolidin-1-yl)methyl]-4-[(2-hydroxyphenyl)methylamino]oxolan-3-ol?
The canonical SMILES for 2-[(3,3-difluoropyrrolidin-1-yl)methyl]-4-[(2-hydroxyphenyl)methylamino]oxolan-3-ol is Oc1ccccc1CNC1COC(CN2CCC(F)(F)C2)C1O.
What is the InChIKey of 2-[(3,3-difluoropyrrolidin-1-yl)methyl]-4-[(2-hydroxyphenyl)methylamino]oxolan-3-ol?
The InChIKey is WLAXFJNVCPAIKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22F2N2O3/c17-16(18)5-6-20(10-16)8-14-15(22)12(9-23-14)19-7-11-3-1-2-4-13(11)21/h1-4,12,14-15,19,21-22H,5-10H2.
What are the key properties of 2-[(3,3-difluoropyrrolidin-1-yl)methyl]-4-[(2-hydroxyphenyl)methylamino]oxolan-3-ol?
2-[(3,3-difluoropyrrolidin-1-yl)methyl]-4-[(2-hydroxyphenyl)methylamino]oxolan-3-ol has a molecular weight of 328.36 g/mol, XLogP of 0.95, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3,3-difluoropyrrolidin-1-yl)methyl]-4-[(2-hydroxyphenyl)methylamino]oxolan-3-ol is sourced from PubChem (CID 162910576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).