C18H28O6 — CID 162910677
1-O-ethyl 4-O-[7-(6-oxo-2,3-dihydropyran-2-yl)heptan-2-yl] butanedioate (PubChem CID 162910677) has the molecular formula C18H28O6 and a molecular weight of 340.42 g/mol. Its IUPAC name is 1-O-ethyl 4-O-[7-(6-oxo-2,3-dihydropyran-2-yl)heptan-2-yl] butanedioate.
| Compound Name | 1-O-ethyl 4-O-[7-(6-oxo-2,3-dihydropyran-2-yl)heptan-2-yl] butanedioate |
|---|---|
| PubChem CID | 162910677 |
| Molecular Formula | C18H28O6 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | 1-O-ethyl 4-O-[7-(6-oxo-2,3-dihydropyran-2-yl)heptan-2-yl] butanedioate |
| SMILES | CCOC(=O)CCC(=O)OC(C)CCCCCC1CC=CC(=O)O1 |
| InChI | InChI=1S/C18H28O6/c1-3-22-16(19)12-13-18(21)23-14(2)8-5-4-6-9-15-10-7-11-17(20)24-15/h7,11,14-15H,3-6,8-10,12-13H2,1-2H3 |
| InChIKey | JHWYWQUBJFEZIU-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|