C23H33N5S — CID 162910864
1-[[(2R,4R,5R)-5-(1-methyl-3-phenylpyrazol-5-yl)-1-azabicyclo[2.2.2]octan-2-yl]methyl]-3-(2-methylpropyl)thiourea (PubChem CID 162910864) has the molecular formula C23H33N5S and a molecular weight of 411.62 g/mol. Its IUPAC name is 1-[[(2R,4R,5R)-5-(1-methyl-3-phenylpyrazol-5-yl)-1-azabicyclo[2.2.2]octan-2-yl]methyl]-3-(2-methylpropyl)thiourea.
| Compound Name | 1-[[(2R,4R,5R)-5-(1-methyl-3-phenylpyrazol-5-yl)-1-azabicyclo[2.2.2]octan-2-yl]methyl]-3-(2-methylpropyl)thiourea |
|---|---|
| PubChem CID | 162910864 |
| Molecular Formula | C23H33N5S |
| Molecular Weight | 411.62 g/mol |
| Exact Mass | 411.25 |
| IUPAC Name | 1-[[(2R,4R,5R)-5-(1-methyl-3-phenylpyrazol-5-yl)-1-azabicyclo[2.2.2]octan-2-yl]methyl]-3-(2-methylpropyl)thiourea |
| SMILES | CC(C)CNC(=S)NC[C@H]1C[C@H]2CCN1C[C@@H]2c1cc(-c2ccccc2)nn1C |
| InChI | InChI=1S/C23H33N5S/c1-16(2)13-24-23(29)25-14-19-11-18-9-10-28(19)15-20(18)22-12-21(26-27(22)3)17-7-5-4-6-8-17/h4-8,12,16,18-20H,9-11,13-15H2,1-3H3,(H2,24,25,29)/t18-,19-,20+/m1/s1 |
| InChIKey | GXDXEYZVXXJDSJ-AQNXPRMDSA-N |
| XLogP | 3.38 |
| TPSA | 45.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.62 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|