C24H34O12 — CID 162910957
[(2S,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl] (4R)-4-(2-hydroxypropan-2-yl)cyclohexene-1-carboxylate (PubChem CID 162910957) has the molecular formula C24H34O12 and a molecular weight of 514.52 g/mol. Its IUPAC name is [(2S,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl] (4R)-4-(2-hydroxypropan-2-yl)cyclohexene-1-carboxylate.
| Compound Name | [(2S,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl] (4R)-4-(2-hydroxypropan-2-yl)cyclohexene-1-carboxylate |
|---|---|
| PubChem CID | 162910957 |
| Molecular Formula | C24H34O12 |
| Molecular Weight | 514.52 g/mol |
| Exact Mass | 514.21 |
| IUPAC Name | [(2S,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl] (4R)-4-(2-hydroxypropan-2-yl)cyclohexene-1-carboxylate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](OC(=O)C2=CC[C@H](C(C)(C)O)CC2)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C24H34O12/c1-12(25)31-11-18-19(32-13(2)26)20(33-14(3)27)21(34-15(4)28)23(35-18)36-22(29)16-7-9-17(10-8-16)24(5,6)30/h7,17-21,23,30H,8-11H2,1-6H3/t17-,18+,19+,20-,21+,23-/m0/s1 |
| InChIKey | RVQWXKAZGHLAJI-CTAFWJRSSA-N |
| XLogP | 1.11 |
| TPSA | 160.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.52 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|